About N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide
N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide (PubChem CID 114632453) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide |
| PubChem CID | 114632453 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)NC1CC(N)C1(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-4-15-6-5-10(14)13-9-7-8(12)11(9,2)3/h8-9H,4-7,12H2,1-3H3,(H,13,14) |
| InChIKey | PJYXJKMVDZLTDW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide?
The IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide (CID 114632453) is N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide?
The canonical SMILES for N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide is CCOCCC(=O)NC1CC(N)C1(C)C.
What is the InChIKey of N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide?
The InChIKey is PJYXJKMVDZLTDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-4-15-6-5-10(14)13-9-7-8(12)11(9,2)3/h8-9H,4-7,12H2,1-3H3,(H,13,14).
What are the key properties of N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide?
N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide has a molecular weight of 214.31 g/mol, XLogP of 0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylcyclobutyl)-3-ethoxypropanamide is sourced from PubChem (CID 114632453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).