About N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide
N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide (PubChem CID 114632493) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide |
| PubChem CID | 114632493 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide |
| SMILES | CCCOCCC(=O)NC1CC(N)C1(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-4-6-16-7-5-11(15)14-10-8-9(13)12(10,2)3/h9-10H,4-8,13H2,1-3H3,(H,14,15) |
| InChIKey | MJIVWZQTBGYPBH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide?
The IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide (CID 114632493) is N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide?
The canonical SMILES for N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide is CCCOCCC(=O)NC1CC(N)C1(C)C.
What is the InChIKey of N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide?
The InChIKey is MJIVWZQTBGYPBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-4-6-16-7-5-11(15)14-10-8-9(13)12(10,2)3/h9-10H,4-8,13H2,1-3H3,(H,14,15).
What are the key properties of N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide?
N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide has a molecular weight of 228.34 g/mol, XLogP of 1.05, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylcyclobutyl)-3-propoxypropanamide is sourced from PubChem (CID 114632493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).