C10H16N4 — CID 114632703
2,2-dimethyl-1-N-pyridazin-3-ylcyclobutane-1,3-diamine (PubChem CID 114632703) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 2,2-dimethyl-1-N-pyridazin-3-ylcyclobutane-1,3-diamine.
| Compound Name | 2,2-dimethyl-1-N-pyridazin-3-ylcyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 114632703 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2,2-dimethyl-1-N-pyridazin-3-ylcyclobutane-1,3-diamine |
| SMILES | CC1(C)C(N)CC1Nc1cccnn1 |
| InChI | InChI=1S/C10H16N4/c1-10(2)7(11)6-8(10)13-9-4-3-5-12-14-9/h3-5,7-8H,6,11H2,1-2H3,(H,13,14) |
| InChIKey | ZAFWUHQNBUECHX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |