About 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one
1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one (PubChem CID 114632801) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one |
| PubChem CID | 114632801 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one |
| SMILES | CNC1CCN(C2CC(O)C2(C)C)C1=O |
| InChI | InChI=1S/C11H20N2O2/c1-11(2)8(6-9(11)14)13-5-4-7(12-3)10(13)15/h7-9,12,14H,4-6H2,1-3H3 |
| InChIKey | ZCJRXMXAOKFJMF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one?
The IUPAC name of 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one (CID 114632801) is 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one.
What is the SMILES notation for 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one?
The canonical SMILES for 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one is CNC1CCN(C2CC(O)C2(C)C)C1=O.
What is the InChIKey of 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one?
The InChIKey is ZCJRXMXAOKFJMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-11(2)8(6-9(11)14)13-5-4-7(12-3)10(13)15/h7-9,12,14H,4-6H2,1-3H3.
What are the key properties of 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one?
1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one has a molecular weight of 212.29 g/mol, XLogP of -0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methylamino)pyrrolidin-2-one is sourced from PubChem (CID 114632801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).