C13H21ClN2O — CID 114633841
1-(4-chloro-1-methylpyrazol-5-yl)-4-propan-2-ylcyclohexan-1-ol (PubChem CID 114633841) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-4-propan-2-ylcyclohexan-1-ol.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-4-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 114633841 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-4-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)C1CCC(O)(c2c(Cl)cnn2C)CC1 |
| InChI | InChI=1S/C13H21ClN2O/c1-9(2)10-4-6-13(17,7-5-10)12-11(14)8-15-16(12)3/h8-10,17H,4-7H2,1-3H3 |
| InChIKey | VMNSDUMIBZGJSZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |