C23H34O5 — CID 11463445
(2R,3S,4E,6S,7Z)-2-[(4S,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-4,6-dimethylnona-4,7-diene-1,3-diol (PubChem CID 11463445) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (2R,3S,4E,6S,7Z)-2-[(4S,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-4,6-dimethylnona-4,7-diene-1,3-diol.
| Compound Name | (2R,3S,4E,6S,7Z)-2-[(4S,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-4,6-dimethylnona-4,7-diene-1,3-diol |
|---|---|
| PubChem CID | 11463445 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (2R,3S,4E,6S,7Z)-2-[(4S,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-4,6-dimethylnona-4,7-diene-1,3-diol |
| SMILES | C/C=C\[C@H](C)/C=C(\C)[C@@H](O)[C@@H](CO)[C@H]1OC(c2ccc(OC)cc2)OC[C@H]1C |
| InChI | InChI=1S/C23H34O5/c1-6-7-15(2)12-16(3)21(25)20(13-24)22-17(4)14-27-23(28-22)18-8-10-19(26-5)11-9-18/h6-12,15,17,20-25H,13-14H2,1-5H3/b7-6-,16-12+/t15-,17+,20+,21+,22-,23?/m0/s1 |
| InChIKey | AULNETLWJCBBRR-XCFNNGBISA-N |
| XLogP | 3.87 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|