About 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid
6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid (PubChem CID 11463454) has the molecular formula C19H19F2N3O4
and a molecular weight of 391.37 g/mol. Its IUPAC name is 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid |
| PubChem CID | 11463454 |
| Molecular Formula | C19H19F2N3O4 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid |
| SMILES | CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C19H19F2N3O4/c1-2-3-15(18(26)24-16-5-4-12(10-22-16)19(27)28)23-17(25)8-11-6-13(20)9-14(21)7-11/h4-7,9-10,15H,2-3,8H2,1H3,(H,23,25)(H,27,28)(H,22,24,26) |
| InChIKey | FMCJTJRSGYIHOS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid?
The IUPAC name of 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid (CID 11463454) is 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid is CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)Nc1ccc(C(=O)O)cn1.
What is the InChIKey of 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid?
The InChIKey is FMCJTJRSGYIHOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2N3O4/c1-2-3-15(18(26)24-16-5-4-12(10-22-16)19(27)28)23-17(25)8-11-6-13(20)9-14(21)7-11/h4-7,9-10,15H,2-3,8H2,1H3,(H,23,25)(H,27,28)(H,22,24,26).
What are the key properties of 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid?
6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid has a molecular weight of 391.37 g/mol, XLogP of 2.52, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanoylamino]pyridine-3-carboxylic acid is sourced from PubChem (CID 11463454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).