C14H17ClN2O4 — CID 114634559
(4-chloro-1-methylpyrazol-5-yl)-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 114634559) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-5-yl)-(3,4,5-trimethoxyphenyl)methanol.
| Compound Name | (4-chloro-1-methylpyrazol-5-yl)-(3,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 114634559 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (4-chloro-1-methylpyrazol-5-yl)-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(C(O)c2c(Cl)cnn2C)cc(OC)c1OC |
| InChI | InChI=1S/C14H17ClN2O4/c1-17-12(9(15)7-16-17)13(18)8-5-10(19-2)14(21-4)11(6-8)20-3/h5-7,13,18H,1-4H3 |
| InChIKey | QEZKETVEWBHSHC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |