C15H19BrN2O — CID 114634828
(4-bromo-1-ethylpyrazol-5-yl)-(2,4,6-trimethylphenyl)methanol (PubChem CID 114634828) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is (4-bromo-1-ethylpyrazol-5-yl)-(2,4,6-trimethylphenyl)methanol.
| Compound Name | (4-bromo-1-ethylpyrazol-5-yl)-(2,4,6-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 114634828 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (4-bromo-1-ethylpyrazol-5-yl)-(2,4,6-trimethylphenyl)methanol |
| SMILES | CCn1ncc(Br)c1C(O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H19BrN2O/c1-5-18-14(12(16)8-17-18)15(19)13-10(3)6-9(2)7-11(13)4/h6-8,15,19H,5H2,1-4H3 |
| InChIKey | YKIWCUHQODROLY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |