C13H12ClF3N2OS — CID 114635096
(4-chloro-1-ethylpyrazol-5-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanol (PubChem CID 114635096) has the molecular formula C13H12ClF3N2OS and a molecular weight of 336.77 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanol.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanol |
|---|---|
| PubChem CID | 114635096 |
| Molecular Formula | C13H12ClF3N2OS |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-[4-(trifluoromethylsulfanyl)phenyl]methanol |
| SMILES | CCn1ncc(Cl)c1C(O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12ClF3N2OS/c1-2-19-11(10(14)7-18-19)12(20)8-3-5-9(6-4-8)21-13(15,16)17/h3-7,12,20H,2H2,1H3 |
| InChIKey | PFZOBOSANOHVQN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |