C14H16ClFN2O2 — CID 114635288
(4-chloro-3-fluorophenyl)-(4-methoxy-1-propan-2-ylpyrazol-5-yl)methanol (PubChem CID 114635288) has the molecular formula C14H16ClFN2O2 and a molecular weight of 298.75 g/mol. Its IUPAC name is (4-chloro-3-fluorophenyl)-(4-methoxy-1-propan-2-ylpyrazol-5-yl)methanol.
| Compound Name | (4-chloro-3-fluorophenyl)-(4-methoxy-1-propan-2-ylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 114635288 |
| Molecular Formula | C14H16ClFN2O2 |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (4-chloro-3-fluorophenyl)-(4-methoxy-1-propan-2-ylpyrazol-5-yl)methanol |
| SMILES | COc1cnn(C(C)C)c1C(O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H16ClFN2O2/c1-8(2)18-13(12(20-3)7-17-18)14(19)9-4-5-10(15)11(16)6-9/h4-8,14,19H,1-3H3 |
| InChIKey | ZPHKDSIXGQLFLV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |