C20H26FNO4S — CID 11463579
diethyl (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-(1-phenylethylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 11463579) has the molecular formula C20H26FNO4S and a molecular weight of 395.50 g/mol. Its IUPAC name is diethyl (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-(1-phenylethylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-(1-phenylethylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 11463579 |
| Molecular Formula | C20H26FNO4S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | diethyl (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-(1-phenylethylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1(N)[C@H]2[C@@H](C[C@H]1SC(C)c1ccccc1)[C@]2(F)C(=O)OCC |
| InChI | InChI=1S/C20H26FNO4S/c1-4-25-17(23)19(21)14-11-15(20(22,16(14)19)18(24)26-5-2)27-12(3)13-9-7-6-8-10-13/h6-10,12,14-16H,4-5,11,22H2,1-3H3/t12?,14-,15-,16+,19-,20+/m1/s1 |
| InChIKey | DFEYSMQTLBVKAQ-SKFJYURHSA-N |
| XLogP | 3.03 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |