C22H29N3O4 — CID 11463707
N-(5-cyclohexyl-1,2-oxazol-3-yl)-2-[(2-hydroxy-2-phenylacetyl)amino]pentanamide (PubChem CID 11463707) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,2-oxazol-3-yl)-2-[(2-hydroxy-2-phenylacetyl)amino]pentanamide.
| Compound Name | N-(5-cyclohexyl-1,2-oxazol-3-yl)-2-[(2-hydroxy-2-phenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 11463707 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-(5-cyclohexyl-1,2-oxazol-3-yl)-2-[(2-hydroxy-2-phenylacetyl)amino]pentanamide |
| SMILES | CCCC(NC(=O)C(O)c1ccccc1)C(=O)Nc1cc(C2CCCCC2)on1 |
| InChI | InChI=1S/C22H29N3O4/c1-2-9-17(23-22(28)20(26)16-12-7-4-8-13-16)21(27)24-19-14-18(29-25-19)15-10-5-3-6-11-15/h4,7-8,12-15,17,20,26H,2-3,5-6,9-11H2,1H3,(H,23,28)(H,24,25,27) |
| InChIKey | LAMYWZDUELEOFQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |