C11H18ClN3O2 — CID 114637213
3-amino-1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]cyclopentan-1-ol (PubChem CID 114637213) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is 3-amino-1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]cyclopentan-1-ol.
| Compound Name | 3-amino-1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 114637213 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-amino-1-[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]cyclopentan-1-ol |
| SMILES | COCCn1ncc(Cl)c1C1(O)CCC(N)C1 |
| InChI | InChI=1S/C11H18ClN3O2/c1-17-5-4-15-10(9(12)7-14-15)11(16)3-2-8(13)6-11/h7-8,16H,2-6,13H2,1H3 |
| InChIKey | CWMOJGYWKPNAMB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |