C6Cl2F12O2 — CID 11463803
1,2-dichloro-1,1,2,3,3-pentafluoro-3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]propane (PubChem CID 11463803) has the molecular formula C6Cl2F12O2 and a molecular weight of 402.95 g/mol. Its IUPAC name is 1,2-dichloro-1,1,2,3,3-pentafluoro-3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]propane.
| Compound Name | 1,2-dichloro-1,1,2,3,3-pentafluoro-3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]propane |
|---|---|
| PubChem CID | 11463803 |
| Molecular Formula | C6Cl2F12O2 |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 401.91 |
| IUPAC Name | 1,2-dichloro-1,1,2,3,3-pentafluoro-3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]propane |
| SMILES | FC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C6Cl2F12O2/c7-1(9,2(8,10)11)3(12,13)21-4(14,15)5(16,17)22-6(18,19)20 |
| InChIKey | JJKGNAPTCKMAHH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|