About (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol
(2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol (PubChem CID 114638417) has the molecular formula C14H20ClN3OS
and a molecular weight of 313.85 g/mol. Its IUPAC name is (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol.
Molecular Properties
| Compound Name | (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol |
| PubChem CID | 114638417 |
| Molecular Formula | C14H20ClN3OS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol |
| SMILES | CC(C)n1ncc(Cl)c1C(O)c1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H20ClN3OS/c1-8(2)18-11(9(15)6-16-18)12(19)10-7-20-13(17-10)14(3,4)5/h6-8,12,19H,1-5H3 |
| InChIKey | XGLAZKADQULLCZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol?
The IUPAC name of (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol (CID 114638417) is (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol.
What is the SMILES notation for (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol?
The canonical SMILES for (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol is CC(C)n1ncc(Cl)c1C(O)c1csc(C(C)(C)C)n1.
What is the InChIKey of (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol?
The InChIKey is XGLAZKADQULLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN3OS/c1-8(2)18-11(9(15)6-16-18)12(19)10-7-20-13(17-10)14(3,4)5/h6-8,12,19H,1-5H3.
What are the key properties of (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol?
(2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol has a molecular weight of 313.85 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-1,3-thiazol-4-yl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol is sourced from PubChem (CID 114638417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).