C26H29N3O3S — CID 1146407
1-cyclopentyl-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 1146407) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-cyclopentyl-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 1146407 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1-cyclopentyl-1-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | C[C@H](NC(=S)N(Cc1cc2cc3c(cc2[nH]c1=O)OCCO3)C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O3S/c1-17(18-7-3-2-4-8-18)27-26(33)29(21-9-5-6-10-21)16-20-13-19-14-23-24(32-12-11-31-23)15-22(19)28-25(20)30/h2-4,7-8,13-15,17,21H,5-6,9-12,16H2,1H3,(H,27,33)(H,28,30)/t17-/m0/s1 |
| InChIKey | NQIHNFAFMHOSKI-KRWDZBQOSA-N |
| XLogP | 4.68 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|