C22H23ClN2S2 — CID 11464139
(1R,14S)-8-chloro-5-ethylsulfanyl-13-methyl-4-thia-6,13-diazapentacyclo[12.8.0.02,10.03,7.017,22]docosa-2,5,7,9,17,19,21-heptaene (PubChem CID 11464139) has the molecular formula C22H23ClN2S2 and a molecular weight of 415.03 g/mol. Its IUPAC name is (1R,14S)-8-chloro-5-ethylsulfanyl-13-methyl-4-thia-6,13-diazapentacyclo[12.8.0.02,10.03,7.017,22]docosa-2,5,7,9,17,19,21-heptaene.
| Compound Name | (1R,14S)-8-chloro-5-ethylsulfanyl-13-methyl-4-thia-6,13-diazapentacyclo[12.8.0.02,10.03,7.017,22]docosa-2,5,7,9,17,19,21-heptaene |
|---|---|
| PubChem CID | 11464139 |
| Molecular Formula | C22H23ClN2S2 |
| Molecular Weight | 415.03 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (1R,14S)-8-chloro-5-ethylsulfanyl-13-methyl-4-thia-6,13-diazapentacyclo[12.8.0.02,10.03,7.017,22]docosa-2,5,7,9,17,19,21-heptaene |
| SMILES | CCSc1nc2c(Cl)cc3c(c2s1)[C@H]1c2ccccc2CC[C@@H]1N(C)CC3 |
| InChI | InChI=1S/C22H23ClN2S2/c1-3-26-22-24-20-16(23)12-14-10-11-25(2)17-9-8-13-6-4-5-7-15(13)19(17)18(14)21(20)27-22/h4-7,12,17,19H,3,8-11H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | FSMSYGHLNZAANU-HKUYNNGSSA-N |
| XLogP | 6.00 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.03 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |