C10H15BrN2O3 — CID 114641403
1-(4-bromo-1-methylpyrazol-5-yl)-2,2-diethoxyethanone (PubChem CID 114641403) has the molecular formula C10H15BrN2O3 and a molecular weight of 291.14 g/mol. Its IUPAC name is 1-(4-bromo-1-methylpyrazol-5-yl)-2,2-diethoxyethanone.
| Compound Name | 1-(4-bromo-1-methylpyrazol-5-yl)-2,2-diethoxyethanone |
|---|---|
| PubChem CID | 114641403 |
| Molecular Formula | C10H15BrN2O3 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(4-bromo-1-methylpyrazol-5-yl)-2,2-diethoxyethanone |
| SMILES | CCOC(OCC)C(=O)c1c(Br)cnn1C |
| InChI | InChI=1S/C10H15BrN2O3/c1-4-15-10(16-5-2)9(14)8-7(11)6-12-13(8)3/h6,10H,4-5H2,1-3H3 |
| InChIKey | SGJJQFNUUWUVCR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|