C14H17FN4O2 — CID 114641932
[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-(3-fluoro-2-pyridinyl)methanone (PubChem CID 114641932) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-(3-fluoro-2-pyridinyl)methanone.
| Compound Name | [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-(3-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 114641932 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-(3-fluoro-2-pyridinyl)methanone |
| SMILES | COc1cnn(CCN(C)C)c1C(=O)c1ncccc1F |
| InChI | InChI=1S/C14H17FN4O2/c1-18(2)7-8-19-13(11(21-3)9-17-19)14(20)12-10(15)5-4-6-16-12/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | FPKTUZQLUIHHQV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |