C25H28N2O2S — CID 11464295
(3aS,4E,6aR)-1,3-dibenzyl-4-(5-oxohexylidene)-6,6a-dihydro-3aH-thieno[3,4-d]imidazol-2-one (PubChem CID 11464295) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is (3aS,4E,6aR)-1,3-dibenzyl-4-(5-oxohexylidene)-6,6a-dihydro-3aH-thieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4E,6aR)-1,3-dibenzyl-4-(5-oxohexylidene)-6,6a-dihydro-3aH-thieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 11464295 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (3aS,4E,6aR)-1,3-dibenzyl-4-(5-oxohexylidene)-6,6a-dihydro-3aH-thieno[3,4-d]imidazol-2-one |
| SMILES | CC(=O)CCC/C=C1/SC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O2S/c1-19(28)10-8-9-15-23-24-22(18-30-23)26(16-20-11-4-2-5-12-20)25(29)27(24)17-21-13-6-3-7-14-21/h2-7,11-15,22,24H,8-10,16-18H2,1H3/b23-15+/t22-,24-/m0/s1 |
| InChIKey | VJOJSFSTUXMLOS-BWSPKHDCSA-N |
| XLogP | 5.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|