C14H14ClF3N2O — CID 114644158
1-(4-chloro-1-ethylpyrazol-5-yl)-2-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 114644158) has the molecular formula C14H14ClF3N2O and a molecular weight of 318.73 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-2-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 114644158 |
| Molecular Formula | C14H14ClF3N2O |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-2-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | CCn1ncc(Cl)c1C(O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14ClF3N2O/c1-2-20-13(11(15)8-19-20)12(21)7-9-4-3-5-10(6-9)14(16,17)18/h3-6,8,12,21H,2,7H2,1H3 |
| InChIKey | OSJPADHBVOLLAS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |