C6H6BrClF2N2O — CID 114645379
1-(4-bromo-1-methylpyrazol-5-yl)-2-chloro-2,2-difluoroethanol (PubChem CID 114645379) has the molecular formula C6H6BrClF2N2O and a molecular weight of 275.48 g/mol. Its IUPAC name is 1-(4-bromo-1-methylpyrazol-5-yl)-2-chloro-2,2-difluoroethanol.
| Compound Name | 1-(4-bromo-1-methylpyrazol-5-yl)-2-chloro-2,2-difluoroethanol |
|---|---|
| PubChem CID | 114645379 |
| Molecular Formula | C6H6BrClF2N2O |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 273.93 |
| IUPAC Name | 1-(4-bromo-1-methylpyrazol-5-yl)-2-chloro-2,2-difluoroethanol |
| SMILES | Cn1ncc(Br)c1C(O)C(F)(F)Cl |
| InChI | InChI=1S/C6H6BrClF2N2O/c1-12-4(3(7)2-11-12)5(13)6(8,9)10/h2,5,13H,1H3 |
| InChIKey | UJPNDALWPRRKKX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|