C14H26N2O3 — CID 114645771
2-ethyl-2-methoxy-1-(4-methoxy-1-propylpyrazol-5-yl)butan-1-ol (PubChem CID 114645771) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-ethyl-2-methoxy-1-(4-methoxy-1-propylpyrazol-5-yl)butan-1-ol.
| Compound Name | 2-ethyl-2-methoxy-1-(4-methoxy-1-propylpyrazol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 114645771 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-ethyl-2-methoxy-1-(4-methoxy-1-propylpyrazol-5-yl)butan-1-ol |
| SMILES | CCCn1ncc(OC)c1C(O)C(CC)(CC)OC |
| InChI | InChI=1S/C14H26N2O3/c1-6-9-16-12(11(18-4)10-15-16)13(17)14(7-2,8-3)19-5/h10,13,17H,6-9H2,1-5H3 |
| InChIKey | GGXUULDNKMDDHT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |