C26H34N4O2 — CID 11464690
2-[4-[(2S)-2-methyl-4-naphthalen-1-ylpiperazin-1-yl]butyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 11464690) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[4-[(2S)-2-methyl-4-naphthalen-1-ylpiperazin-1-yl]butyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-[4-[(2S)-2-methyl-4-naphthalen-1-ylpiperazin-1-yl]butyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 11464690 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2-[4-[(2S)-2-methyl-4-naphthalen-1-ylpiperazin-1-yl]butyl]-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | C[C@H]1CN(c2cccc3ccccc23)CCN1CCCCN1CC(=O)N2CCCC2C1=O |
| InChI | InChI=1S/C26H34N4O2/c1-20-18-28(23-11-6-9-21-8-2-3-10-22(21)23)17-16-27(20)13-4-5-14-29-19-25(31)30-15-7-12-24(30)26(29)32/h2-3,6,8-11,20,24H,4-5,7,12-19H2,1H3/t20-,24?/m0/s1 |
| InChIKey | IPDAZPXSBHMPGF-QHELBMECSA-N |
| XLogP | 2.96 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|