C18H35BrO3Si2 — CID 11464726
[(1S,2S,5R,6R)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11464726) has the molecular formula C18H35BrO3Si2 and a molecular weight of 435.55 g/mol. Its IUPAC name is [(1S,2S,5R,6R)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S,5R,6R)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11464726 |
| Molecular Formula | C18H35BrO3Si2 |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [(1S,2S,5R,6R)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[4.1.0]hept-3-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(Br)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C18H35BrO3Si2/c1-17(2,3)23(7,8)21-13-11-12(19)14(16-15(13)20-16)22-24(9,10)18(4,5)6/h11,13-16H,1-10H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | DZRKGPAWOJEFNO-LVQVYYBASA-N |
| XLogP | 5.83 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|