C10H18ClN3 — CID 114647778
1-(4-chloro-1-methylpyrazol-5-yl)-N-propylpropan-1-amine (PubChem CID 114647778) has the molecular formula C10H18ClN3 and a molecular weight of 215.73 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 114647778 |
| Molecular Formula | C10H18ClN3 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H18ClN3/c1-4-6-12-9(5-2)10-8(11)7-13-14(10)3/h7,9,12H,4-6H2,1-3H3 |
| InChIKey | TYRBMSYNQORAEN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |