C10H18BrN3 — CID 114648705
1-(4-bromo-1-methylpyrazol-5-yl)-4-methylpentan-1-amine (PubChem CID 114648705) has the molecular formula C10H18BrN3 and a molecular weight of 260.18 g/mol. Its IUPAC name is 1-(4-bromo-1-methylpyrazol-5-yl)-4-methylpentan-1-amine.
| Compound Name | 1-(4-bromo-1-methylpyrazol-5-yl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 114648705 |
| Molecular Formula | C10H18BrN3 |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 1-(4-bromo-1-methylpyrazol-5-yl)-4-methylpentan-1-amine |
| SMILES | CC(C)CCC(N)c1c(Br)cnn1C |
| InChI | InChI=1S/C10H18BrN3/c1-7(2)4-5-9(12)10-8(11)6-13-14(10)3/h6-7,9H,4-5,12H2,1-3H3 |
| InChIKey | RYDBKHUNHGYNKM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |