C15H20BrClN4 — CID 114650064
2-(2-bromophenyl)-1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]ethanamine (PubChem CID 114650064) has the molecular formula C15H20BrClN4 and a molecular weight of 371.71 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]ethanamine.
| Compound Name | 2-(2-bromophenyl)-1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 114650064 |
| Molecular Formula | C15H20BrClN4 |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-(2-bromophenyl)-1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]ethanamine |
| SMILES | CN(C)CCn1ncc(Cl)c1C(N)Cc1ccccc1Br |
| InChI | InChI=1S/C15H20BrClN4/c1-20(2)7-8-21-15(13(17)10-19-21)14(18)9-11-5-3-4-6-12(11)16/h3-6,10,14H,7-9,18H2,1-2H3 |
| InChIKey | ABKTVUSKNLXHFH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |