About tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate
tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate (PubChem CID 11465046) has the molecular formula C26H29N2O3P
and a molecular weight of 448.50 g/mol. Its IUPAC name is tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate |
| PubChem CID | 11465046 |
| Molecular Formula | C26H29N2O3P |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)/C(=N\P(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N2O3P/c1-20(27-25(29)31-26(2,3)4)24(21-14-8-5-9-15-21)28-32(30,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20H,1-4H3,(H,27,29)/b28-24+/t20-/m0/s1 |
| InChIKey | GXCHAUJRMFUBEJ-XITAALQNSA-N |
| XLogP | 5.32 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate (CID 11465046) is tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate is C[C@H](NC(=O)OC(C)(C)C)/C(=N\P(=O)(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate?
The InChIKey is GXCHAUJRMFUBEJ-XITAALQNSA-N. The full InChI is InChI=1S/C26H29N2O3P/c1-20(27-25(29)31-26(2,3)4)24(21-14-8-5-9-15-21)28-32(30,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20H,1-4H3,(H,27,29)/b28-24+/t20-/m0/s1.
What are the key properties of tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate?
tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate has a molecular weight of 448.50 g/mol, XLogP of 5.32, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1Z,2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate is sourced from PubChem (CID 11465046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).