C13H15N3 — CID 114650892
1-(2-cyano-5-methylcyclohexyl)pyrrole-2-carbonitrile (PubChem CID 114650892) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(2-cyano-5-methylcyclohexyl)pyrrole-2-carbonitrile.
| Compound Name | 1-(2-cyano-5-methylcyclohexyl)pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 114650892 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-(2-cyano-5-methylcyclohexyl)pyrrole-2-carbonitrile |
| SMILES | CC1CCC(C#N)C(n2cccc2C#N)C1 |
| InChI | InChI=1S/C13H15N3/c1-10-4-5-11(8-14)13(7-10)16-6-2-3-12(16)9-15/h2-3,6,10-11,13H,4-5,7H2,1H3 |
| InChIKey | PKGNSICSEDKUDR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |