C12H12BrClFN3 — CID 114651102
1-(4-bromo-1-methylpyrazol-5-yl)-1-(4-chloro-2-fluorophenyl)-N-methylmethanamine (PubChem CID 114651102) has the molecular formula C12H12BrClFN3 and a molecular weight of 332.60 g/mol. Its IUPAC name is 1-(4-bromo-1-methylpyrazol-5-yl)-1-(4-chloro-2-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-1-methylpyrazol-5-yl)-1-(4-chloro-2-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114651102 |
| Molecular Formula | C12H12BrClFN3 |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 1-(4-bromo-1-methylpyrazol-5-yl)-1-(4-chloro-2-fluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Cl)cc1F)c1c(Br)cnn1C |
| InChI | InChI=1S/C12H12BrClFN3/c1-16-11(12-9(13)6-17-18(12)2)8-4-3-7(14)5-10(8)15/h3-6,11,16H,1-2H3 |
| InChIKey | AIVFUNOMHJDHKI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |