C16H32N4O — CID 114651746
1-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-2-methyl-N-propylbutan-1-amine (PubChem CID 114651746) has the molecular formula C16H32N4O and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-2-methyl-N-propylbutan-1-amine.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-2-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 114651746 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]-4-methoxypyrazol-5-yl]-2-methyl-N-propylbutan-1-amine |
| SMILES | CCCNC(c1c(OC)cnn1CCN(C)C)C(C)CC |
| InChI | InChI=1S/C16H32N4O/c1-7-9-17-15(13(3)8-2)16-14(21-6)12-18-20(16)11-10-19(4)5/h12-13,15,17H,7-11H2,1-6H3 |
| InChIKey | YVXCBRMJDPNQFF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |