C23H27N5O3S — CID 11465185
1-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-3-(2-methylquinolin-4-yl)urea (PubChem CID 11465185) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 1-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-3-(2-methylquinolin-4-yl)urea.
| Compound Name | 1-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-3-(2-methylquinolin-4-yl)urea |
|---|---|
| PubChem CID | 11465185 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 1-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-3-(2-methylquinolin-4-yl)urea |
| SMILES | Cc1cc(NC(=O)NCCN2CCN(S(=O)(=O)c3ccccc3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C23H27N5O3S/c1-18-17-22(20-9-5-6-10-21(20)25-18)26-23(29)24-11-12-27-13-15-28(16-14-27)32(30,31)19-7-3-2-4-8-19/h2-10,17H,11-16H2,1H3,(H2,24,25,26,29) |
| InChIKey | CQRCCGLLPRTFAK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |