C23H26N4O4S — CID 11465208
methyl N-[1-butanoyl-5-[4-(butanoylamino)phenyl]sulfanylbenzimidazol-2-yl]carbamate (PubChem CID 11465208) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is methyl N-[1-butanoyl-5-[4-(butanoylamino)phenyl]sulfanylbenzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[1-butanoyl-5-[4-(butanoylamino)phenyl]sulfanylbenzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 11465208 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | methyl N-[1-butanoyl-5-[4-(butanoylamino)phenyl]sulfanylbenzimidazol-2-yl]carbamate |
| SMILES | CCCC(=O)Nc1ccc(Sc2ccc3c(c2)nc(NC(=O)OC)n3C(=O)CCC)cc1 |
| InChI | InChI=1S/C23H26N4O4S/c1-4-6-20(28)24-15-8-10-16(11-9-15)32-17-12-13-19-18(14-17)25-22(26-23(30)31-3)27(19)21(29)7-5-2/h8-14H,4-7H2,1-3H3,(H,24,28)(H,25,26,30) |
| InChIKey | ZKLMYFTZJHJTCX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |