C15H17N5O — CID 114652591
1-(4-methoxy-1-methylpyrazol-5-yl)-N-methyl-1-quinoxalin-6-ylmethanamine (PubChem CID 114652591) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-(4-methoxy-1-methylpyrazol-5-yl)-N-methyl-1-quinoxalin-6-ylmethanamine.
| Compound Name | 1-(4-methoxy-1-methylpyrazol-5-yl)-N-methyl-1-quinoxalin-6-ylmethanamine |
|---|---|
| PubChem CID | 114652591 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-(4-methoxy-1-methylpyrazol-5-yl)-N-methyl-1-quinoxalin-6-ylmethanamine |
| SMILES | CNC(c1ccc2nccnc2c1)c1c(OC)cnn1C |
| InChI | InChI=1S/C15H17N5O/c1-16-14(15-13(21-3)9-19-20(15)2)10-4-5-11-12(8-10)18-7-6-17-11/h4-9,14,16H,1-3H3 |
| InChIKey | GZCKVGFNGUQDPZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |