C11H15N3O — CID 114652595
N-tert-butyl-2-(2-cyanopyrrol-1-yl)acetamide (PubChem CID 114652595) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-tert-butyl-2-(2-cyanopyrrol-1-yl)acetamide.
| Compound Name | N-tert-butyl-2-(2-cyanopyrrol-1-yl)acetamide |
|---|---|
| PubChem CID | 114652595 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-tert-butyl-2-(2-cyanopyrrol-1-yl)acetamide |
| SMILES | CC(C)(C)NC(=O)Cn1cccc1C#N |
| InChI | InChI=1S/C11H15N3O/c1-11(2,3)13-10(15)8-14-6-4-5-9(14)7-12/h4-6H,8H2,1-3H3,(H,13,15) |
| InChIKey | IXZFQMTYPMPURZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |