C17H12F5N3O — CID 11465261
1-[(4aR,9aS)-2,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3-yl]-2-(2,3,4,5,6-pentafluorophenyl)hydrazine (PubChem CID 11465261) has the molecular formula C17H12F5N3O and a molecular weight of 369.29 g/mol. Its IUPAC name is 1-[(4aR,9aS)-2,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3-yl]-2-(2,3,4,5,6-pentafluorophenyl)hydrazine.
| Compound Name | 1-[(4aR,9aS)-2,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3-yl]-2-(2,3,4,5,6-pentafluorophenyl)hydrazine |
|---|---|
| PubChem CID | 11465261 |
| Molecular Formula | C17H12F5N3O |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 1-[(4aR,9aS)-2,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3-yl]-2-(2,3,4,5,6-pentafluorophenyl)hydrazine |
| SMILES | Fc1c(F)c(F)c(NNC2=N[C@@H]3c4ccccc4C[C@@H]3OC2)c(F)c1F |
| InChI | InChI=1S/C17H12F5N3O/c18-11-12(19)14(21)17(15(22)13(11)20)25-24-10-6-26-9-5-7-3-1-2-4-8(7)16(9)23-10/h1-4,9,16,25H,5-6H2,(H,23,24)/t9-,16+/m0/s1 |
| InChIKey | JPZHHTKXNLTEAO-XXFAHNHDSA-N |
| XLogP | 3.39 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|