C14H20BrN3OS — CID 114652685
N-[(5-bromothiophen-2-yl)-(4-methoxy-1-propan-2-ylpyrazol-5-yl)methyl]ethanamine (PubChem CID 114652685) has the molecular formula C14H20BrN3OS and a molecular weight of 358.31 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)-(4-methoxy-1-propan-2-ylpyrazol-5-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromothiophen-2-yl)-(4-methoxy-1-propan-2-ylpyrazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114652685 |
| Molecular Formula | C14H20BrN3OS |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)-(4-methoxy-1-propan-2-ylpyrazol-5-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)s1)c1c(OC)cnn1C(C)C |
| InChI | InChI=1S/C14H20BrN3OS/c1-5-16-13(11-6-7-12(15)20-11)14-10(19-4)8-17-18(14)9(2)3/h6-9,13,16H,5H2,1-4H3 |
| InChIKey | UGIHJLMMXZHKBI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |