C13H14BrClFN3 — CID 114653033
1-(4-bromo-1-ethylpyrazol-5-yl)-1-(3-chloro-2-fluorophenyl)-N-methylmethanamine (PubChem CID 114653033) has the molecular formula C13H14BrClFN3 and a molecular weight of 346.63 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-1-(3-chloro-2-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-1-(3-chloro-2-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114653033 |
| Molecular Formula | C13H14BrClFN3 |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-1-(3-chloro-2-fluorophenyl)-N-methylmethanamine |
| SMILES | CCn1ncc(Br)c1C(NC)c1cccc(Cl)c1F |
| InChI | InChI=1S/C13H14BrClFN3/c1-3-19-13(9(14)7-18-19)12(17-2)8-5-4-6-10(15)11(8)16/h4-7,12,17H,3H2,1-2H3 |
| InChIKey | XQWDYBCLIAKGAR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |