C14H25N3OS — CID 114654144
2-cyclopentylsulfanyl-N-ethyl-1-(4-methoxy-1-methylpyrazol-5-yl)ethanamine (PubChem CID 114654144) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-ethyl-1-(4-methoxy-1-methylpyrazol-5-yl)ethanamine.
| Compound Name | 2-cyclopentylsulfanyl-N-ethyl-1-(4-methoxy-1-methylpyrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 114654144 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-ethyl-1-(4-methoxy-1-methylpyrazol-5-yl)ethanamine |
| SMILES | CCNC(CSC1CCCC1)c1c(OC)cnn1C |
| InChI | InChI=1S/C14H25N3OS/c1-4-15-12(10-19-11-7-5-6-8-11)14-13(18-3)9-16-17(14)2/h9,11-12,15H,4-8,10H2,1-3H3 |
| InChIKey | SDDDVOFAQAYGJC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |