About 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide
1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide (PubChem CID 114654301) has the molecular formula C8H8N4S2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide.
Molecular Properties
| Compound Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide |
| PubChem CID | 114654301 |
| Molecular Formula | C8H8N4S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide |
| SMILES | Cc1nnc(-n2cccc2C(N)=S)s1 |
| InChI | InChI=1S/C8H8N4S2/c1-5-10-11-8(14-5)12-4-2-3-6(12)7(9)13/h2-4H,1H3,(H2,9,13) |
| InChIKey | IEGWYMRUSCRJNC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide?
The IUPAC name of 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide (CID 114654301) is 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide.
What is the SMILES notation for 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide?
The canonical SMILES for 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide is Cc1nnc(-n2cccc2C(N)=S)s1.
What is the InChIKey of 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide?
The InChIKey is IEGWYMRUSCRJNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S2/c1-5-10-11-8(14-5)12-4-2-3-6(12)7(9)13/h2-4H,1H3,(H2,9,13).
What are the key properties of 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide?
1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide has a molecular weight of 224.31 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrole-2-carbothioamide is sourced from PubChem (CID 114654301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).