C10H8N6S — CID 114654480
1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrole-2-carbothioamide (PubChem CID 114654480) has the molecular formula C10H8N6S and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrole-2-carbothioamide.
| Compound Name | 1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrole-2-carbothioamide |
|---|---|
| PubChem CID | 114654480 |
| Molecular Formula | C10H8N6S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)pyrrole-2-carbothioamide |
| SMILES | NC(=S)c1cccn1-c1nccn2cnnc12 |
| InChI | InChI=1S/C10H8N6S/c11-8(17)7-2-1-4-16(7)9-10-14-13-6-15(10)5-3-12-9/h1-6H,(H2,11,17) |
| InChIKey | XCBUJLVHHVLGFV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 74.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|