C25H28N4O3S — CID 11465449
N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]-N,N-bis[(4-methylphenyl)methyl]methanimidamide (PubChem CID 11465449) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]-N,N-bis[(4-methylphenyl)methyl]methanimidamide.
| Compound Name | N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]-N,N-bis[(4-methylphenyl)methyl]methanimidamide |
|---|---|
| PubChem CID | 11465449 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]-N,N-bis[(4-methylphenyl)methyl]methanimidamide |
| SMILES | Cc1ccc(CN(/C=N/c2ccn([C@H]3CS[C@@H](CO)O3)c(=O)n2)Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O3S/c1-18-3-7-20(8-4-18)13-28(14-21-9-5-19(2)6-10-21)17-26-22-11-12-29(25(31)27-22)23-16-33-24(15-30)32-23/h3-12,17,23-24,30H,13-16H2,1-2H3/b26-17+/t23-,24+/m1/s1 |
| InChIKey | DBPFPVQLHWMNQN-SEVWNOFWSA-N |
| XLogP | 3.80 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|