C14H17Br2N3S — CID 114656321
1-(4-bromo-1-ethylpyrazol-5-yl)-2-(2-bromophenyl)sulfanyl-N-methylethanamine (PubChem CID 114656321) has the molecular formula C14H17Br2N3S and a molecular weight of 419.19 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-2-(2-bromophenyl)sulfanyl-N-methylethanamine.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-2-(2-bromophenyl)sulfanyl-N-methylethanamine |
|---|---|
| PubChem CID | 114656321 |
| Molecular Formula | C14H17Br2N3S |
| Molecular Weight | 419.19 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-2-(2-bromophenyl)sulfanyl-N-methylethanamine |
| SMILES | CCn1ncc(Br)c1C(CSc1ccccc1Br)NC |
| InChI | InChI=1S/C14H17Br2N3S/c1-3-19-14(11(16)8-18-19)12(17-2)9-20-13-7-5-4-6-10(13)15/h4-8,12,17H,3,9H2,1-2H3 |
| InChIKey | LHRNBHUYRCCKQU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.19 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |