C28H31ClN4O — CID 11465667
N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]-1H-indole-3-carboxamide (PubChem CID 11465667) has the molecular formula C28H31ClN4O and a molecular weight of 475.04 g/mol. Its IUPAC name is N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]-1H-indole-3-carboxamide.
| Compound Name | N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 11465667 |
| Molecular Formula | C28H31ClN4O |
| Molecular Weight | 475.04 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]-1H-indole-3-carboxamide |
| SMILES | O=C(NCCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H31ClN4O/c29-19-13-14-22-26(17-19)33-25-12-6-4-10-21(25)27(22)30-15-7-1-2-8-16-31-28(34)23-18-32-24-11-5-3-9-20(23)24/h3,5,9,11,13-14,17-18,32H,1-2,4,6-8,10,12,15-16H2,(H,30,33)(H,31,34) |
| InChIKey | BNYZFCXUCLRASW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.04 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|