C29H25N5O2 — CID 11465678
4-benzo[g]quinazolin-4-yl-N-(4-phenoxyphenyl)piperazine-1-carboxamide (PubChem CID 11465678) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-benzo[g]quinazolin-4-yl-N-(4-phenoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-benzo[g]quinazolin-4-yl-N-(4-phenoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11465678 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-benzo[g]quinazolin-4-yl-N-(4-phenoxyphenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)N1CCN(c2ncnc3cc4ccccc4cc23)CC1 |
| InChI | InChI=1S/C29H25N5O2/c35-29(32-23-10-12-25(13-11-23)36-24-8-2-1-3-9-24)34-16-14-33(15-17-34)28-26-18-21-6-4-5-7-22(21)19-27(26)30-20-31-28/h1-13,18-20H,14-17H2,(H,32,35) |
| InChIKey | WUMSDXSFFRGZLF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|