C25H44O9 — CID 11465948
[(2R,3S,4S,5R,7S,9S,10S,11R,12S,13R)-7,10,12-trihydroxy-2-[(2S,3S)-3-hydroxybutan-2-yl]-3,5,7,9,11,13-hexamethyl-6,14-dioxo-oxacyclotetradec-4-yl] acetate (PubChem CID 11465948) has the molecular formula C25H44O9 and a molecular weight of 488.62 g/mol. Its IUPAC name is [(2R,3S,4S,5R,7S,9S,10S,11R,12S,13R)-7,10,12-trihydroxy-2-[(2S,3S)-3-hydroxybutan-2-yl]-3,5,7,9,11,13-hexamethyl-6,14-dioxo-oxacyclotetradec-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,7S,9S,10S,11R,12S,13R)-7,10,12-trihydroxy-2-[(2S,3S)-3-hydroxybutan-2-yl]-3,5,7,9,11,13-hexamethyl-6,14-dioxo-oxacyclotetradec-4-yl] acetate |
|---|---|
| PubChem CID | 11465948 |
| Molecular Formula | C25H44O9 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | [(2R,3S,4S,5R,7S,9S,10S,11R,12S,13R)-7,10,12-trihydroxy-2-[(2S,3S)-3-hydroxybutan-2-yl]-3,5,7,9,11,13-hexamethyl-6,14-dioxo-oxacyclotetradec-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](C)[C@@H]([C@@H](C)[C@H](C)O)OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)C[C@](C)(O)C(=O)[C@@H]1C |
| InChI | InChI=1S/C25H44O9/c1-11-10-25(9,32)23(30)16(6)22(33-18(8)27)15(5)21(12(2)17(7)26)34-24(31)14(4)20(29)13(3)19(11)28/h11-17,19-22,26,28-29,32H,10H2,1-9H3/t11-,12-,13+,14+,15-,16+,17-,19-,20-,21+,22-,25-/m0/s1 |
| InChIKey | LKVWHIITUZPSGU-RJTGUELUSA-N |
| XLogP | 1.47 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |