C29H44O6 — CID 11465950
2-(6-hydroxy-5,5-dimethylhexyl)-6-[3-[6-(6-hydroxy-5,5-dimethylhexyl)-4-oxopyran-2-yl]propyl]pyran-4-one (PubChem CID 11465950) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is 2-(6-hydroxy-5,5-dimethylhexyl)-6-[3-[6-(6-hydroxy-5,5-dimethylhexyl)-4-oxopyran-2-yl]propyl]pyran-4-one.
| Compound Name | 2-(6-hydroxy-5,5-dimethylhexyl)-6-[3-[6-(6-hydroxy-5,5-dimethylhexyl)-4-oxopyran-2-yl]propyl]pyran-4-one |
|---|---|
| PubChem CID | 11465950 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 2-(6-hydroxy-5,5-dimethylhexyl)-6-[3-[6-(6-hydroxy-5,5-dimethylhexyl)-4-oxopyran-2-yl]propyl]pyran-4-one |
| SMILES | CC(C)(CO)CCCCc1cc(=O)cc(CCCc2cc(=O)cc(CCCCC(C)(C)CO)o2)o1 |
| InChI | InChI=1S/C29H44O6/c1-28(2,20-30)14-7-5-10-24-16-22(32)18-26(34-24)12-9-13-27-19-23(33)17-25(35-27)11-6-8-15-29(3,4)21-31/h16-19,30-31H,5-15,20-21H2,1-4H3 |
| InChIKey | KKSQMMGFOBEUSV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|