C29H33ClN4O — CID 11465956
N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]-1H-indole-3-carboxamide (PubChem CID 11465956) has the molecular formula C29H33ClN4O and a molecular weight of 489.06 g/mol. Its IUPAC name is N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]-1H-indole-3-carboxamide.
| Compound Name | N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 11465956 |
| Molecular Formula | C29H33ClN4O |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[7-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]heptyl]-1H-indole-3-carboxamide |
| SMILES | O=C(NCCCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H33ClN4O/c30-20-14-15-23-27(18-20)34-26-13-7-5-11-22(26)28(23)31-16-8-2-1-3-9-17-32-29(35)24-19-33-25-12-6-4-10-21(24)25/h4,6,10,12,14-15,18-19,33H,1-3,5,7-9,11,13,16-17H2,(H,31,34)(H,32,35) |
| InChIKey | FAYCJMALFQZDBF-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|